About [N'-(3-bromo-2,6-dimethylphenyl)carbamimidoyl]urea
[N'-(3-bromo-2,6-dimethylphenyl)carbamimidoyl]urea (PubChem CID 135990637) has the molecular formula C10H13BrN4O
and a molecular weight of 285.15 g/mol. Its IUPAC name is [N'-(3-bromo-2,6-dimethylphenyl)carbamimidoyl]urea.
Molecular Properties
| Compound Name | [N'-(3-bromo-2,6-dimethylphenyl)carbamimidoyl]urea |
| PubChem CID | 135990637 |
| Molecular Formula | C10H13BrN4O |
| Molecular Weight | 285.15 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | [N'-(3-bromo-2,6-dimethylphenyl)carbamimidoyl]urea |
| SMILES | Cc1ccc(Br)c(C)c1/N=C(\N)NC(N)=O |
| InChI | InChI=1S/C10H13BrN4O/c1-5-3-4-7(11)6(2)8(5)14-9(12)15-10(13)16/h3-4H,1-2H3,(H5,12,13,14,15,16) |
| InChIKey | JAWRAVBUDZHYTB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.15 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [N'-(3-bromo-2,6-dimethylphenyl)carbamimidoyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [N'-(3-bromo-2,6-dimethylphenyl)carbamimidoyl]urea?
The IUPAC name of [N'-(3-bromo-2,6-dimethylphenyl)carbamimidoyl]urea (CID 135990637) is [N'-(3-bromo-2,6-dimethylphenyl)carbamimidoyl]urea.
What is the SMILES notation for [N'-(3-bromo-2,6-dimethylphenyl)carbamimidoyl]urea?
The canonical SMILES for [N'-(3-bromo-2,6-dimethylphenyl)carbamimidoyl]urea is Cc1ccc(Br)c(C)c1/N=C(\N)NC(N)=O.
What is the InChIKey of [N'-(3-bromo-2,6-dimethylphenyl)carbamimidoyl]urea?
The InChIKey is JAWRAVBUDZHYTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN4O/c1-5-3-4-7(11)6(2)8(5)14-9(12)15-10(13)16/h3-4H,1-2H3,(H5,12,13,14,15,16).
What are the key properties of [N'-(3-bromo-2,6-dimethylphenyl)carbamimidoyl]urea?
[N'-(3-bromo-2,6-dimethylphenyl)carbamimidoyl]urea has a molecular weight of 285.15 g/mol, XLogP of 1.68, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [N'-(3-bromo-2,6-dimethylphenyl)carbamimidoyl]urea is sourced from PubChem (CID 135990637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).