C15H18N6OS — CID 135990802
2-[[methyl(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)amino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 135990802) has the molecular formula C15H18N6OS and a molecular weight of 330.42 g/mol. Its IUPAC name is 2-[[methyl(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)amino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[[methyl(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)amino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135990802 |
| Molecular Formula | C15H18N6OS |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-[[methyl(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)amino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | CN(Cc1cc2n(n1)CCNC2)Cc1nc2ccsc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H18N6OS/c1-20(8-10-6-11-7-16-3-4-21(11)19-10)9-13-17-12-2-5-23-14(12)15(22)18-13/h2,5-6,16H,3-4,7-9H2,1H3,(H,17,18,22) |
| InChIKey | GBZIGFNXQQFWIK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |