C14H15N3O — CID 135991240
2-(2-bicyclo[2.2.1]hept-1-enylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 135991240) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-1-enylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 2-(2-bicyclo[2.2.1]hept-1-enylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135991240 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-1-enylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CC2=C3CCC(C3)C2)nc2cc[nH]c12 |
| InChI | InChI=1S/C14H15N3O/c18-14-13-11(3-4-15-13)16-12(17-14)7-10-6-8-1-2-9(10)5-8/h3-4,8,15H,1-2,5-7H2,(H,16,17,18) |
| InChIKey | JKETVBJTFUYAEE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|