2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxylic acid

C7H7N5O3 — CID 135991651

IUPAC2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxylic acid
SMILESNc1nc2c(c(=O)[nH]1)N=C(C(=O)O)CN2
InChIInChI=1S/C7H7N5O3/c8-7-11-4-3(5(13)12-7)10-2(1-9-4)6(14)15/h1H2,(H,14,15)(H4,8,9,11,12,13)
InChIKeyIEFMEURWCRZZJQ-UHFFFAOYSA-N
MW209.16 g/mol
LogP-1.07
Rot. Bonds1

About 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxylic acid

2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxylic acid (PubChem CID 135991651) has the molecular formula C7H7N5O3 and a molecular weight of 209.16 g/mol. Its IUPAC name is 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxylic acid.

Molecular Properties

Compound Name2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxylic acid
PubChem CID135991651
Molecular FormulaC7H7N5O3
Molecular Weight209.16 g/mol
Exact Mass209.05
IUPAC Name2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxylic acid
SMILESNc1nc2c(c(=O)[nH]1)N=C(C(=O)O)CN2
InChIInChI=1S/C7H7N5O3/c8-7-11-4-3(5(13)12-7)10-2(1-9-4)6(14)15/h1H2,(H,14,15)(H4,8,9,11,12,13)
InChIKeyIEFMEURWCRZZJQ-UHFFFAOYSA-N
XLogP-1.07
TPSA133.46 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.16
LogP ≤ 5-1.07
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Analyze 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxylic acid?
The IUPAC name of 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxylic acid (CID 135991651) is 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxylic acid.
What is the SMILES notation for 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxylic acid?
The canonical SMILES for 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxylic acid is Nc1nc2c(c(=O)[nH]1)N=C(C(=O)O)CN2.
What is the InChIKey of 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxylic acid?
The InChIKey is IEFMEURWCRZZJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5O3/c8-7-11-4-3(5(13)12-7)10-2(1-9-4)6(14)15/h1H2,(H,14,15)(H4,8,9,11,12,13).
What are the key properties of 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxylic acid?
2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxylic acid has a molecular weight of 209.16 g/mol, XLogP of -1.07, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxylic acid is sourced from PubChem (CID 135991651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).