About ethyl (Z)-3-(3-chloro-2,4-difluoro-5-nitrophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate
ethyl (Z)-3-(3-chloro-2,4-difluoro-5-nitrophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate (PubChem CID 135991883) has the molecular formula C15H13ClF2N2O5
and a molecular weight of 374.73 g/mol. Its IUPAC name is ethyl (Z)-3-(3-chloro-2,4-difluoro-5-nitrophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-3-(3-chloro-2,4-difluoro-5-nitrophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate |
| PubChem CID | 135991883 |
| Molecular Formula | C15H13ClF2N2O5 |
| Molecular Weight | 374.73 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | ethyl (Z)-3-(3-chloro-2,4-difluoro-5-nitrophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/C1CC1)=C(\O)c1cc([N+](=O)[O-])c(F)c(Cl)c1F |
| InChI | InChI=1S/C15H13ClF2N2O5/c1-2-25-15(22)9(6-19-7-3-4-7)14(21)8-5-10(20(23)24)13(18)11(16)12(8)17/h5-7,21H,2-4H2,1H3/b14-9-,19-6+ |
| InChIKey | VYDMCPHFTKOJQD-ZXZZXYTASA-N |
| XLogP | 3.59 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.73 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-3-(3-chloro-2,4-difluoro-5-nitrophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-3-(3-chloro-2,4-difluoro-5-nitrophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate?
The IUPAC name of ethyl (Z)-3-(3-chloro-2,4-difluoro-5-nitrophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate (CID 135991883) is ethyl (Z)-3-(3-chloro-2,4-difluoro-5-nitrophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate.
What is the SMILES notation for ethyl (Z)-3-(3-chloro-2,4-difluoro-5-nitrophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate?
The canonical SMILES for ethyl (Z)-3-(3-chloro-2,4-difluoro-5-nitrophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate is CCOC(=O)C(/C=N/C1CC1)=C(\O)c1cc([N+](=O)[O-])c(F)c(Cl)c1F.
What is the InChIKey of ethyl (Z)-3-(3-chloro-2,4-difluoro-5-nitrophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate?
The InChIKey is VYDMCPHFTKOJQD-ZXZZXYTASA-N. The full InChI is InChI=1S/C15H13ClF2N2O5/c1-2-25-15(22)9(6-19-7-3-4-7)14(21)8-5-10(20(23)24)13(18)11(16)12(8)17/h5-7,21H,2-4H2,1H3/b14-9-,19-6+.
What are the key properties of ethyl (Z)-3-(3-chloro-2,4-difluoro-5-nitrophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate?
ethyl (Z)-3-(3-chloro-2,4-difluoro-5-nitrophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate has a molecular weight of 374.73 g/mol, XLogP of 3.59, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-3-(3-chloro-2,4-difluoro-5-nitrophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate is sourced from PubChem (CID 135991883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).