C13H18N6O3 — CID 135992586
2-amino-7-(3-aminoprop-1-ynyl)-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one (PubChem CID 135992586) has the molecular formula C13H18N6O3 and a molecular weight of 306.33 g/mol. Its IUPAC name is 2-amino-7-(3-aminoprop-1-ynyl)-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one.
| Compound Name | 2-amino-7-(3-aminoprop-1-ynyl)-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one |
|---|---|
| PubChem CID | 135992586 |
| Molecular Formula | C13H18N6O3 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-amino-7-(3-aminoprop-1-ynyl)-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one |
| SMILES | NCC#CN1CN([C@H]2CC[C@@H](CO)O2)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C13H18N6O3/c14-4-1-5-18-7-19(9-3-2-8(6-20)22-9)11-10(18)12(21)17-13(15)16-11/h8-9,20H,2-4,6-7,14H2,(H3,15,16,17,21)/t8-,9+/m0/s1 |
| InChIKey | BJYREFAONKDWHA-DTWKUNHWSA-N |
| XLogP | -1.65 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|