About 2-methylidenebutan-1-ol
2-methylidenebutan-1-ol (PubChem CID 135993183) has the molecular formula C5H9O+
and a molecular weight of 85.13 g/mol. Its IUPAC name is 2-methylidenebutan-1-ol.
Molecular Properties
| Compound Name | 2-methylidenebutan-1-ol |
| PubChem CID | 135993183 |
| Molecular Formula | C5H9O+ |
| Molecular Weight | 85.13 g/mol |
| Exact Mass | 85.06 |
| IUPAC Name | 2-methylidenebutan-1-ol |
| SMILES | C=C(C[CH2+])CO |
| InChI | InChI=1S/C5H9O/c1-3-5(2)4-6/h6H,1-4H2/q+1 |
| InChIKey | RRWIJYLQKABIHK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.13 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenebutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenebutan-1-ol?
The IUPAC name of 2-methylidenebutan-1-ol (CID 135993183) is 2-methylidenebutan-1-ol.
What is the SMILES notation for 2-methylidenebutan-1-ol?
The canonical SMILES for 2-methylidenebutan-1-ol is C=C(C[CH2+])CO.
What is the InChIKey of 2-methylidenebutan-1-ol?
The InChIKey is RRWIJYLQKABIHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9O/c1-3-5(2)4-6/h6H,1-4H2/q+1.
What are the key properties of 2-methylidenebutan-1-ol?
2-methylidenebutan-1-ol has a molecular weight of 85.13 g/mol, XLogP of 0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenebutan-1-ol is sourced from PubChem (CID 135993183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).