About iridium;4-methyl-2-phenyl-6-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid
iridium;4-methyl-2-phenyl-6-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid (PubChem CID 135993594) has the molecular formula C19H14F3IrN2O2-
and a molecular weight of 551.54 g/mol. Its IUPAC name is iridium;4-methyl-2-phenyl-6-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | iridium;4-methyl-2-phenyl-6-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid |
| PubChem CID | 135993594 |
| Molecular Formula | C19H14F3IrN2O2- |
| Molecular Weight | 551.54 g/mol |
| Exact Mass | 552.06 |
| IUPAC Name | iridium;4-methyl-2-phenyl-6-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid |
| SMILES | Cc1cc(-c2[c-]cccc2)nc(C(F)(F)F)c1.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C13H9F3N.C6H5NO2.Ir/c1-9-7-11(10-5-3-2-4-6-10)17-12(8-9)13(14,15)16;8-6(9)5-3-1-2-4-7-5;/h2-5,7-8H,1H3;1-4H,(H,8,9);/q-1;; |
| InChIKey | FQJLFZZBJWTJHM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 551.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;4-methyl-2-phenyl-6-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;4-methyl-2-phenyl-6-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid?
The IUPAC name of iridium;4-methyl-2-phenyl-6-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid (CID 135993594) is iridium;4-methyl-2-phenyl-6-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid.
What is the SMILES notation for iridium;4-methyl-2-phenyl-6-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid?
The canonical SMILES for iridium;4-methyl-2-phenyl-6-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid is Cc1cc(-c2[c-]cccc2)nc(C(F)(F)F)c1.O=C(O)c1ccccn1.[Ir].
What is the InChIKey of iridium;4-methyl-2-phenyl-6-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid?
The InChIKey is FQJLFZZBJWTJHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F3N.C6H5NO2.Ir/c1-9-7-11(10-5-3-2-4-6-10)17-12(8-9)13(14,15)16;8-6(9)5-3-1-2-4-7-5;/h2-5,7-8H,1H3;1-4H,(H,8,9);/q-1;;.
What are the key properties of iridium;4-methyl-2-phenyl-6-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid?
iridium;4-methyl-2-phenyl-6-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid has a molecular weight of 551.54 g/mol, XLogP of 4.65, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;4-methyl-2-phenyl-6-(trifluoromethyl)pyridine;pyridine-2-carboxylic acid is sourced from PubChem (CID 135993594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).