C9H8N4OS — CID 135993697
3,5-dimethyl-7-thia-4,5,10,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,11-tetraen-9-one (PubChem CID 135993697) has the molecular formula C9H8N4OS and a molecular weight of 220.26 g/mol. Its IUPAC name is 3,5-dimethyl-7-thia-4,5,10,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,11-tetraen-9-one.
| Compound Name | 3,5-dimethyl-7-thia-4,5,10,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,11-tetraen-9-one |
|---|---|
| PubChem CID | 135993697 |
| Molecular Formula | C9H8N4OS |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 3,5-dimethyl-7-thia-4,5,10,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,11-tetraen-9-one |
| SMILES | Cc1nn(C)c2sc3c(=O)[nH]cnc3c12 |
| InChI | InChI=1S/C9H8N4OS/c1-4-5-6-7(8(14)11-3-10-6)15-9(5)13(2)12-4/h3H,1-2H3,(H,10,11,14) |
| InChIKey | YCVWBBWJVCFSQB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |