About 2,4-dichloro-1,2-dihydroquinazoline
2,4-dichloro-1,2-dihydroquinazoline (PubChem CID 135995139) has the molecular formula C8H6Cl2N2
and a molecular weight of 201.06 g/mol. Its IUPAC name is 2,4-dichloro-1,2-dihydroquinazoline.
Molecular Properties
| Compound Name | 2,4-dichloro-1,2-dihydroquinazoline |
| PubChem CID | 135995139 |
| Molecular Formula | C8H6Cl2N2 |
| Molecular Weight | 201.06 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | 2,4-dichloro-1,2-dihydroquinazoline |
| SMILES | ClC1=NC(Cl)Nc2ccccc21 |
| InChI | InChI=1S/C8H6Cl2N2/c9-7-5-3-1-2-4-6(5)11-8(10)12-7/h1-4,8,11H |
| InChIKey | XSEACQPQGRFWRL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.06 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloro-1,2-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-1,2-dihydroquinazoline?
The IUPAC name of 2,4-dichloro-1,2-dihydroquinazoline (CID 135995139) is 2,4-dichloro-1,2-dihydroquinazoline.
What is the SMILES notation for 2,4-dichloro-1,2-dihydroquinazoline?
The canonical SMILES for 2,4-dichloro-1,2-dihydroquinazoline is ClC1=NC(Cl)Nc2ccccc21.
What is the InChIKey of 2,4-dichloro-1,2-dihydroquinazoline?
The InChIKey is XSEACQPQGRFWRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2N2/c9-7-5-3-1-2-4-6(5)11-8(10)12-7/h1-4,8,11H.
What are the key properties of 2,4-dichloro-1,2-dihydroquinazoline?
2,4-dichloro-1,2-dihydroquinazoline has a molecular weight of 201.06 g/mol, XLogP of 2.62, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-1,2-dihydroquinazoline is sourced from PubChem (CID 135995139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).