C19H21N3O3 — CID 135995150
(E)-3-[[4-(aminomethyl)phenyl]diazenyl]-4-hydroxy-5-(2-methoxyphenyl)pent-3-en-2-one (PubChem CID 135995150) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is (E)-3-[[4-(aminomethyl)phenyl]diazenyl]-4-hydroxy-5-(2-methoxyphenyl)pent-3-en-2-one.
| Compound Name | (E)-3-[[4-(aminomethyl)phenyl]diazenyl]-4-hydroxy-5-(2-methoxyphenyl)pent-3-en-2-one |
|---|---|
| PubChem CID | 135995150 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (E)-3-[[4-(aminomethyl)phenyl]diazenyl]-4-hydroxy-5-(2-methoxyphenyl)pent-3-en-2-one |
| SMILES | COc1ccccc1C/C(O)=C(\N=N\c1ccc(CN)cc1)C(C)=O |
| InChI | InChI=1S/C19H21N3O3/c1-13(23)19(22-21-16-9-7-14(12-20)8-10-16)17(24)11-15-5-3-4-6-18(15)25-2/h3-10,24H,11-12,20H2,1-2H3/b19-17+,22-21+ |
| InChIKey | FOUKLIWXXWAYMF-WRVMAFBXSA-N |
| XLogP | 3.84 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|