About ethyl 3-[3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]propanoate
ethyl 3-[3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]propanoate (PubChem CID 135995613) has the molecular formula C14H21N3O4
and a molecular weight of 295.34 g/mol. Its IUPAC name is ethyl 3-[3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]propanoate |
| PubChem CID | 135995613 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | ethyl 3-[3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)CCc1c(C)nc(C)[nH]c1=O |
| InChI | InChI=1S/C14H21N3O4/c1-4-21-13(19)7-8-15-12(18)6-5-11-9(2)16-10(3)17-14(11)20/h4-8H2,1-3H3,(H,15,18)(H,16,17,20) |
| InChIKey | IDKLAYDIXQREPL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-[3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]propanoate?
The IUPAC name of ethyl 3-[3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]propanoate (CID 135995613) is ethyl 3-[3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]propanoate.
What is the SMILES notation for ethyl 3-[3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]propanoate?
The canonical SMILES for ethyl 3-[3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]propanoate is CCOC(=O)CCNC(=O)CCc1c(C)nc(C)[nH]c1=O.
What is the InChIKey of ethyl 3-[3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]propanoate?
The InChIKey is IDKLAYDIXQREPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O4/c1-4-21-13(19)7-8-15-12(18)6-5-11-9(2)16-10(3)17-14(11)20/h4-8H2,1-3H3,(H,15,18)(H,16,17,20).
What are the key properties of ethyl 3-[3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]propanoate?
ethyl 3-[3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]propanoate has a molecular weight of 295.34 g/mol, XLogP of 0.39, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)propanoylamino]propanoate is sourced from PubChem (CID 135995613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).