C13H27N3S — CID 135995709
2-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]-N,N,4-trimethylpentan-1-amine (PubChem CID 135995709) has the molecular formula C13H27N3S and a molecular weight of 257.45 g/mol. Its IUPAC name is 2-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]-N,N,4-trimethylpentan-1-amine.
| Compound Name | 2-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]-N,N,4-trimethylpentan-1-amine |
|---|---|
| PubChem CID | 135995709 |
| Molecular Formula | C13H27N3S |
| Molecular Weight | 257.45 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 2-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]-N,N,4-trimethylpentan-1-amine |
| SMILES | CC(C)CC(CN(C)C)/N=C1/NC(C)(C)CS1 |
| InChI | InChI=1S/C13H27N3S/c1-10(2)7-11(8-16(5)6)14-12-15-13(3,4)9-17-12/h10-11H,7-9H2,1-6H3,(H,14,15) |
| InChIKey | OHRKOZPRFFOGGE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|