C21H14ClFN4O2 — CID 135995910
1-[4-[(5-chloro-2-oxo-1H-indol-3-ylidene)amino]phenyl]-3-(4-fluorophenyl)urea (PubChem CID 135995910) has the molecular formula C21H14ClFN4O2 and a molecular weight of 408.82 g/mol. Its IUPAC name is 1-[4-[(5-chloro-2-oxo-1H-indol-3-ylidene)amino]phenyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[4-[(5-chloro-2-oxo-1H-indol-3-ylidene)amino]phenyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 135995910 |
| Molecular Formula | C21H14ClFN4O2 |
| Molecular Weight | 408.82 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 1-[4-[(5-chloro-2-oxo-1H-indol-3-ylidene)amino]phenyl]-3-(4-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1ccc(/N=C2\C(=O)Nc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C21H14ClFN4O2/c22-12-1-10-18-17(11-12)19(20(28)27-18)24-14-6-8-16(9-7-14)26-21(29)25-15-4-2-13(23)3-5-15/h1-11H,(H,24,27,28)(H2,25,26,29) |
| InChIKey | KRTVCRUXXBNZBC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.82 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|