About 2-[3-(3,4-dihydroxyphenyl)-1H-pyrazol-5-yl]benzene-1,3-diol
2-[3-(3,4-dihydroxyphenyl)-1H-pyrazol-5-yl]benzene-1,3-diol (PubChem CID 135995957) has the molecular formula C15H12N2O4
and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-[3-(3,4-dihydroxyphenyl)-1H-pyrazol-5-yl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 2-[3-(3,4-dihydroxyphenyl)-1H-pyrazol-5-yl]benzene-1,3-diol |
| PubChem CID | 135995957 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-[3-(3,4-dihydroxyphenyl)-1H-pyrazol-5-yl]benzene-1,3-diol |
| SMILES | Oc1ccc(-c2cc(-c3c(O)cccc3O)[nH]n2)cc1O |
| InChI | InChI=1S/C15H12N2O4/c18-11-5-4-8(6-14(11)21)9-7-10(17-16-9)15-12(19)2-1-3-13(15)20/h1-7,18-21H,(H,16,17) |
| InChIKey | XQBDGOIVZGLYPT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(3,4-dihydroxyphenyl)-1H-pyrazol-5-yl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3,4-dihydroxyphenyl)-1H-pyrazol-5-yl]benzene-1,3-diol?
The IUPAC name of 2-[3-(3,4-dihydroxyphenyl)-1H-pyrazol-5-yl]benzene-1,3-diol (CID 135995957) is 2-[3-(3,4-dihydroxyphenyl)-1H-pyrazol-5-yl]benzene-1,3-diol.
What is the SMILES notation for 2-[3-(3,4-dihydroxyphenyl)-1H-pyrazol-5-yl]benzene-1,3-diol?
The canonical SMILES for 2-[3-(3,4-dihydroxyphenyl)-1H-pyrazol-5-yl]benzene-1,3-diol is Oc1ccc(-c2cc(-c3c(O)cccc3O)[nH]n2)cc1O.
What is the InChIKey of 2-[3-(3,4-dihydroxyphenyl)-1H-pyrazol-5-yl]benzene-1,3-diol?
The InChIKey is XQBDGOIVZGLYPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O4/c18-11-5-4-8(6-14(11)21)9-7-10(17-16-9)15-12(19)2-1-3-13(15)20/h1-7,18-21H,(H,16,17).
What are the key properties of 2-[3-(3,4-dihydroxyphenyl)-1H-pyrazol-5-yl]benzene-1,3-diol?
2-[3-(3,4-dihydroxyphenyl)-1H-pyrazol-5-yl]benzene-1,3-diol has a molecular weight of 284.27 g/mol, XLogP of 2.57, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3,4-dihydroxyphenyl)-1H-pyrazol-5-yl]benzene-1,3-diol is sourced from PubChem (CID 135995957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).