C16H15F4NO3 — CID 135996459
ethyl (E)-2-[(2-fluorocyclopropyl)iminomethyl]-3-hydroxy-3-(2,4,5-trifluoro-3-methylphenyl)prop-2-enoate (PubChem CID 135996459) has the molecular formula C16H15F4NO3 and a molecular weight of 345.29 g/mol. Its IUPAC name is ethyl (E)-2-[(2-fluorocyclopropyl)iminomethyl]-3-hydroxy-3-(2,4,5-trifluoro-3-methylphenyl)prop-2-enoate.
| Compound Name | ethyl (E)-2-[(2-fluorocyclopropyl)iminomethyl]-3-hydroxy-3-(2,4,5-trifluoro-3-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 135996459 |
| Molecular Formula | C16H15F4NO3 |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | ethyl (E)-2-[(2-fluorocyclopropyl)iminomethyl]-3-hydroxy-3-(2,4,5-trifluoro-3-methylphenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/C1CC1F)=C(/O)c1cc(F)c(F)c(C)c1F |
| InChI | InChI=1S/C16H15F4NO3/c1-3-24-16(23)9(6-21-12-5-10(12)17)15(22)8-4-11(18)14(20)7(2)13(8)19/h4,6,10,12,22H,3,5H2,1-2H3/b15-9+,21-6+ |
| InChIKey | OJBNTQVLUKOWQU-SMDXOVKASA-N |
| XLogP | 3.43 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|