C22H30N4O8S3 — CID 135996533
ethyl 4-[[5-(diethylsulfamoyl)-4-hydroxythiophen-3-yl]amino]-3-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1,1-dioxo-1,2-thiazole-5-carboxylate (PubChem CID 135996533) has the molecular formula C22H30N4O8S3 and a molecular weight of 574.70 g/mol. Its IUPAC name is ethyl 4-[[5-(diethylsulfamoyl)-4-hydroxythiophen-3-yl]amino]-3-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1,1-dioxo-1,2-thiazole-5-carboxylate.
| Compound Name | ethyl 4-[[5-(diethylsulfamoyl)-4-hydroxythiophen-3-yl]amino]-3-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1,1-dioxo-1,2-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 135996533 |
| Molecular Formula | C22H30N4O8S3 |
| Molecular Weight | 574.70 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | ethyl 4-[[5-(diethylsulfamoyl)-4-hydroxythiophen-3-yl]amino]-3-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1,1-dioxo-1,2-thiazole-5-carboxylate |
| SMILES | CCOC(=O)C1=C(Nc2csc(S(=O)(=O)N(CC)CC)c2O)/C(=N/[C@H](CC)c2ccc(C)o2)NS1(=O)=O |
| InChI | InChI=1S/C22H30N4O8S3/c1-6-14(16-11-10-13(5)34-16)24-20-17(19(21(28)33-9-4)36(29,30)25-20)23-15-12-35-22(18(15)27)37(31,32)26(7-2)8-3/h10-12,14,23,27H,6-9H2,1-5H3,(H,24,25)/t14-/m1/s1 |
| InChIKey | YRLKPLUONGGUKS-CQSZACIVSA-N |
| XLogP | 3.06 |
| TPSA | 167.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.70 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|