About CID 135996730
CID 135996730 (PubChem CID 135996730) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol.
Molecular Properties
| Compound Name | CID 135996730 |
| PubChem CID | 135996730 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | — |
| SMILES | [CH]c1nc(C)c(C)c(=O)[nH]1 |
| InChI | InChI=1S/C7H8N2O/c1-4-5(2)8-6(3)9-7(4)10/h3H,1-2H3,(H,8,9,10) |
| InChIKey | JTLSVRYSWHVCRA-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 135996730 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135996730?
The IUPAC name of CID 135996730 (CID 135996730) is not available.
What is the SMILES notation for CID 135996730?
The canonical SMILES for CID 135996730 is [CH]c1nc(C)c(C)c(=O)[nH]1.
What is the InChIKey of CID 135996730?
The InChIKey is JTLSVRYSWHVCRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c1-4-5(2)8-6(3)9-7(4)10/h3H,1-2H3,(H,8,9,10).
What are the key properties of CID 135996730?
CID 135996730 has a molecular weight of 136.15 g/mol, XLogP of 0.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135996730 is sourced from PubChem (CID 135996730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).