About aminoazanium;5-(6-nitro-1-oxidobenzotriazol-1-ium-2-yl)-1H-pyrazol-3-olate
aminoazanium;5-(6-nitro-1-oxidobenzotriazol-1-ium-2-yl)-1H-pyrazol-3-olate (PubChem CID 135996809) has the molecular formula C9H10N8O4
and a molecular weight of 294.23 g/mol. Its IUPAC name is aminoazanium;5-(6-nitro-1-oxidobenzotriazol-1-ium-2-yl)-1H-pyrazol-3-olate.
Molecular Properties
| Compound Name | aminoazanium;5-(6-nitro-1-oxidobenzotriazol-1-ium-2-yl)-1H-pyrazol-3-olate |
| PubChem CID | 135996809 |
| Molecular Formula | C9H10N8O4 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | aminoazanium;5-(6-nitro-1-oxidobenzotriazol-1-ium-2-yl)-1H-pyrazol-3-olate |
| SMILES | N[NH3+].O=[N+]([O-])c1ccc2nn(-c3cc([O-])n[nH]3)[n+]([O-])c2c1 |
| InChI | InChI=1S/C9H6N6O4.H4N2/c16-9-4-8(10-11-9)13-12-6-2-1-5(15(18)19)3-7(6)14(13)17;1-2/h1-4H,(H2,10,11,16);1-2H2 |
| InChIKey | DMLXVUJTBCJUFC-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 193.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze aminoazanium;5-(6-nitro-1-oxidobenzotriazol-1-ium-2-yl)-1H-pyrazol-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminoazanium;5-(6-nitro-1-oxidobenzotriazol-1-ium-2-yl)-1H-pyrazol-3-olate?
The IUPAC name of aminoazanium;5-(6-nitro-1-oxidobenzotriazol-1-ium-2-yl)-1H-pyrazol-3-olate (CID 135996809) is aminoazanium;5-(6-nitro-1-oxidobenzotriazol-1-ium-2-yl)-1H-pyrazol-3-olate.
What is the SMILES notation for aminoazanium;5-(6-nitro-1-oxidobenzotriazol-1-ium-2-yl)-1H-pyrazol-3-olate?
The canonical SMILES for aminoazanium;5-(6-nitro-1-oxidobenzotriazol-1-ium-2-yl)-1H-pyrazol-3-olate is N[NH3+].O=[N+]([O-])c1ccc2nn(-c3cc([O-])n[nH]3)[n+]([O-])c2c1.
What is the InChIKey of aminoazanium;5-(6-nitro-1-oxidobenzotriazol-1-ium-2-yl)-1H-pyrazol-3-olate?
The InChIKey is DMLXVUJTBCJUFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N6O4.H4N2/c16-9-4-8(10-11-9)13-12-6-2-1-5(15(18)19)3-7(6)14(13)17;1-2/h1-4H,(H2,10,11,16);1-2H2.
What are the key properties of aminoazanium;5-(6-nitro-1-oxidobenzotriazol-1-ium-2-yl)-1H-pyrazol-3-olate?
aminoazanium;5-(6-nitro-1-oxidobenzotriazol-1-ium-2-yl)-1H-pyrazol-3-olate has a molecular weight of 294.23 g/mol, XLogP of -2.53, 2 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for aminoazanium;5-(6-nitro-1-oxidobenzotriazol-1-ium-2-yl)-1H-pyrazol-3-olate is sourced from PubChem (CID 135996809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).