C20H21N7O6 — CID 135997377
2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylimino]cyclohex-2-ene-1-carbonyl]amino]-4-methylidenepentanedioic acid (PubChem CID 135997377) has the molecular formula C20H21N7O6 and a molecular weight of 455.43 g/mol. Its IUPAC name is 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylimino]cyclohex-2-ene-1-carbonyl]amino]-4-methylidenepentanedioic acid.
| Compound Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylimino]cyclohex-2-ene-1-carbonyl]amino]-4-methylidenepentanedioic acid |
|---|---|
| PubChem CID | 135997377 |
| Molecular Formula | C20H21N7O6 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylimino]cyclohex-2-ene-1-carbonyl]amino]-4-methylidenepentanedioic acid |
| SMILES | C=C(CC(NC(=O)C1C=C/C(=N\Cc2cnc3nc(N)[nH]c(=O)c3n2)CC1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H21N7O6/c1-9(18(30)31)6-13(19(32)33)25-16(28)10-2-4-11(5-3-10)22-7-12-8-23-15-14(24-12)17(29)27-20(21)26-15/h2,4,8,10,13H,1,3,5-7H2,(H,25,28)(H,30,31)(H,32,33)(H3,21,23,26,27,29)/b22-11+ |
| InChIKey | LVHOETQIKSEEIN-SSDVNMTOSA-N |
| XLogP | -0.20 |
| TPSA | 213.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|