C28H23NO — CID 135997437
4-methyl-2-(9-methylfluoren-9-yl)-6-(phenyliminomethyl)phenol (PubChem CID 135997437) has the molecular formula C28H23NO and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-methyl-2-(9-methylfluoren-9-yl)-6-(phenyliminomethyl)phenol.
| Compound Name | 4-methyl-2-(9-methylfluoren-9-yl)-6-(phenyliminomethyl)phenol |
|---|---|
| PubChem CID | 135997437 |
| Molecular Formula | C28H23NO |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 4-methyl-2-(9-methylfluoren-9-yl)-6-(phenyliminomethyl)phenol |
| SMILES | Cc1cc(/C=N/c2ccccc2)c(O)c(C2(C)c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C28H23NO/c1-19-16-20(18-29-21-10-4-3-5-11-21)27(30)26(17-19)28(2)24-14-8-6-12-22(24)23-13-7-9-15-25(23)28/h3-18,30H,1-2H3/b29-18+ |
| InChIKey | QVSXHLLFTDOSRN-RDRPBHBLSA-N |
| XLogP | 6.79 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|