C6H2BrF5N2O — CID 135997677
5-bromo-4-(1,1,2,2,2-pentafluoroethyl)-1H-pyrimidin-6-one (PubChem CID 135997677) has the molecular formula C6H2BrF5N2O and a molecular weight of 292.99 g/mol. Its IUPAC name is 5-bromo-4-(1,1,2,2,2-pentafluoroethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-(1,1,2,2,2-pentafluoroethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135997677 |
| Molecular Formula | C6H2BrF5N2O |
| Molecular Weight | 292.99 g/mol |
| Exact Mass | 291.93 |
| IUPAC Name | 5-bromo-4-(1,1,2,2,2-pentafluoroethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(C(F)(F)C(F)(F)F)c1Br |
| InChI | InChI=1S/C6H2BrF5N2O/c7-2-3(13-1-14-4(2)15)5(8,9)6(10,11)12/h1H,(H,13,14,15) |
| InChIKey | CYCUETWLWUJERU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.99 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|