C19H22N6O2 — CID 135997757
14-[2-(dimethylamino)ethyl]-N,N-dimethyl-10-nitro-8,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-4-amine (PubChem CID 135997757) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 14-[2-(dimethylamino)ethyl]-N,N-dimethyl-10-nitro-8,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-4-amine.
| Compound Name | 14-[2-(dimethylamino)ethyl]-N,N-dimethyl-10-nitro-8,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-4-amine |
|---|---|
| PubChem CID | 135997757 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 14-[2-(dimethylamino)ethyl]-N,N-dimethyl-10-nitro-8,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-4-amine |
| SMILES | CN(C)CCn1nc2c3c(c([N+](=O)[O-])ccc31)Nc1ccc(N(C)C)cc1-2 |
| InChI | InChI=1S/C19H22N6O2/c1-22(2)9-10-24-15-7-8-16(25(26)27)19-17(15)18(21-24)13-11-12(23(3)4)5-6-14(13)20-19/h5-8,11,20H,9-10H2,1-4H3 |
| InChIKey | LRFCZTYGRPKSLZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|