C34H35Cl3N6O4 — CID 135997822
N-ethyl-N-[3-[[4-[(4-methoxyphenyl)diazenyl]-5-oxo-1-(2,4,6-trichlorophenyl)pyrazolidin-3-ylidene]amino]phenyl]-4,6-dimethyl-1-oxaspiro[2.5]octane-2-carboxamide (PubChem CID 135997822) has the molecular formula C34H35Cl3N6O4 and a molecular weight of 698.05 g/mol. Its IUPAC name is N-ethyl-N-[3-[[4-[(4-methoxyphenyl)diazenyl]-5-oxo-1-(2,4,6-trichlorophenyl)pyrazolidin-3-ylidene]amino]phenyl]-4,6-dimethyl-1-oxaspiro[2.5]octane-2-carboxamide.
| Compound Name | N-ethyl-N-[3-[[4-[(4-methoxyphenyl)diazenyl]-5-oxo-1-(2,4,6-trichlorophenyl)pyrazolidin-3-ylidene]amino]phenyl]-4,6-dimethyl-1-oxaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 135997822 |
| Molecular Formula | C34H35Cl3N6O4 |
| Molecular Weight | 698.05 g/mol |
| Exact Mass | 696.18 |
| IUPAC Name | N-ethyl-N-[3-[[4-[(4-methoxyphenyl)diazenyl]-5-oxo-1-(2,4,6-trichlorophenyl)pyrazolidin-3-ylidene]amino]phenyl]-4,6-dimethyl-1-oxaspiro[2.5]octane-2-carboxamide |
| SMILES | CCN(C(=O)C1OC12CCC(C)CC2C)c1cccc(/N=C2\NN(c3c(Cl)cc(Cl)cc3Cl)C(=O)C2/N=N/c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C34H35Cl3N6O4/c1-5-42(33(45)30-34(47-30)14-13-19(2)15-20(34)3)24-8-6-7-23(18-24)38-31-28(40-39-22-9-11-25(46-4)12-10-22)32(44)43(41-31)29-26(36)16-21(35)17-27(29)37/h6-12,16-20,28,30H,5,13-15H2,1-4H3,(H,38,41)/b40-39+ |
| InChIKey | ZEIKIQXMKUWLCC-XQQUEIPISA-N |
| XLogP | 8.34 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.05 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|