C6H4FN3O — CID 135997975
2-fluoro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 135997975) has the molecular formula C6H4FN3O and a molecular weight of 153.12 g/mol. Its IUPAC name is 2-fluoro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-fluoro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 135997975 |
| Molecular Formula | C6H4FN3O |
| Molecular Weight | 153.12 g/mol |
| Exact Mass | 153.03 |
| IUPAC Name | 2-fluoro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | O=c1[nH]c(F)nn2cccc12 |
| InChI | InChI=1S/C6H4FN3O/c7-6-8-5(11)4-2-1-3-10(4)9-6/h1-3H,(H,8,9,11) |
| InChIKey | BHKGHXUCKSKPRF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.12 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |