C28H41N4O2S+ — CID 135998113
[1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl 2,2-dimethyloctanoate (PubChem CID 135998113) has the molecular formula C28H41N4O2S+ and a molecular weight of 497.73 g/mol. Its IUPAC name is [1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl 2,2-dimethyloctanoate.
| Compound Name | [1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl 2,2-dimethyloctanoate |
|---|---|
| PubChem CID | 135998113 |
| Molecular Formula | C28H41N4O2S+ |
| Molecular Weight | 497.73 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | [1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl 2,2-dimethyloctanoate |
| SMILES | CCCCCCC(C)(C)C(=O)OC[N+]1(C)CCN(C2=Nc3ccccc3Nc3sc(C)cc32)CC1 |
| InChI | InChI=1S/C28H41N4O2S/c1-6-7-8-11-14-28(3,4)27(33)34-20-32(5)17-15-31(16-18-32)25-22-19-21(2)35-26(22)30-24-13-10-9-12-23(24)29-25/h9-10,12-13,19,30H,6-8,11,14-18,20H2,1-5H3/q+1 |
| InChIKey | GQWVWGCWFXAFOY-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.73 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|