C36H55N4O2S+ — CID 135998142
[1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl (Z)-octadec-9-enoate (PubChem CID 135998142) has the molecular formula C36H55N4O2S+ and a molecular weight of 607.93 g/mol. Its IUPAC name is [1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl (Z)-octadec-9-enoate.
| Compound Name | [1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 135998142 |
| Molecular Formula | C36H55N4O2S+ |
| Molecular Weight | 607.93 g/mol |
| Exact Mass | 607.40 |
| IUPAC Name | [1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[N+]1(C)CCN(C2=Nc3ccccc3Nc3sc(C)cc32)CC1 |
| InChI | InChI=1S/C36H55N4O2S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-34(41)42-29-40(3)26-24-39(25-27-40)35-31-28-30(2)43-36(31)38-33-22-20-19-21-32(33)37-35/h11-12,19-22,28,38H,4-10,13-18,23-27,29H2,1-3H3/q+1/b12-11- |
| InChIKey | VOWDNSBUNQKZHK-QXMHVHEDSA-N |
| XLogP | 9.49 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.93 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|