C30H45N4O2S+ — CID 135998148
[1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl 2,2-dimethyldecanoate (PubChem CID 135998148) has the molecular formula C30H45N4O2S+ and a molecular weight of 525.78 g/mol. Its IUPAC name is [1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl 2,2-dimethyldecanoate.
| Compound Name | [1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl 2,2-dimethyldecanoate |
|---|---|
| PubChem CID | 135998148 |
| Molecular Formula | C30H45N4O2S+ |
| Molecular Weight | 525.78 g/mol |
| Exact Mass | 525.33 |
| IUPAC Name | [1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl 2,2-dimethyldecanoate |
| SMILES | CCCCCCCCC(C)(C)C(=O)OC[N+]1(C)CCN(C2=Nc3ccccc3Nc3sc(C)cc32)CC1 |
| InChI | InChI=1S/C30H45N4O2S/c1-6-7-8-9-10-13-16-30(3,4)29(35)36-22-34(5)19-17-33(18-20-34)27-24-21-23(2)37-28(24)32-26-15-12-11-14-25(26)31-27/h11-12,14-15,21,32H,6-10,13,16-20,22H2,1-5H3/q+1 |
| InChIKey | KUKMSOJMRUUXPL-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.78 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|