C32H49N4O2S+ — CID 135998154
[1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl 2-hexyloctanoate (PubChem CID 135998154) has the molecular formula C32H49N4O2S+ and a molecular weight of 553.84 g/mol. Its IUPAC name is [1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl 2-hexyloctanoate.
| Compound Name | [1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl 2-hexyloctanoate |
|---|---|
| PubChem CID | 135998154 |
| Molecular Formula | C32H49N4O2S+ |
| Molecular Weight | 553.84 g/mol |
| Exact Mass | 553.36 |
| IUPAC Name | [1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl 2-hexyloctanoate |
| SMILES | CCCCCCC(CCCCCC)C(=O)OC[N+]1(C)CCN(C2=Nc3ccccc3Nc3sc(C)cc32)CC1 |
| InChI | InChI=1S/C32H49N4O2S/c1-5-7-9-11-15-26(16-12-10-8-6-2)32(37)38-24-36(4)21-19-35(20-22-36)30-27-23-25(3)39-31(27)34-29-18-14-13-17-28(29)33-30/h13-14,17-18,23,26,34H,5-12,15-16,19-22,24H2,1-4H3/q+1 |
| InChIKey | MLIUPGUYUPZGJN-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.84 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|