C26H26N4O2 — CID 135998426
11-[4-[(dimethylamino)methyl]phenyl]-12-(4-methoxyphenyl)-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one (PubChem CID 135998426) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 11-[4-[(dimethylamino)methyl]phenyl]-12-(4-methoxyphenyl)-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one.
| Compound Name | 11-[4-[(dimethylamino)methyl]phenyl]-12-(4-methoxyphenyl)-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
|---|---|
| PubChem CID | 135998426 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 11-[4-[(dimethylamino)methyl]phenyl]-12-(4-methoxyphenyl)-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
| SMILES | COc1ccc(C2c3n[nH]c(=O)c4cccc(c34)NC2c2ccc(CN(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O2/c1-30(2)15-16-7-9-18(10-8-16)24-22(17-11-13-19(32-3)14-12-17)25-23-20(26(31)29-28-25)5-4-6-21(23)27-24/h4-14,22,24,27H,15H2,1-3H3,(H,29,31) |
| InChIKey | UFIRGOYQXUGEGK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |