C10H12ClN3O3 — CID 135998497
6-(3-chloropropoxy)-5-methoxy-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 135998497) has the molecular formula C10H12ClN3O3 and a molecular weight of 257.68 g/mol. Its IUPAC name is 6-(3-chloropropoxy)-5-methoxy-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 6-(3-chloropropoxy)-5-methoxy-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 135998497 |
| Molecular Formula | C10H12ClN3O3 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 6-(3-chloropropoxy)-5-methoxy-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | COc1c(OCCCCl)cn2nc[nH]c(=O)c12 |
| InChI | InChI=1S/C10H12ClN3O3/c1-16-9-7(17-4-2-3-11)5-14-8(9)10(15)12-6-13-14/h5-6H,2-4H2,1H3,(H,12,13,15) |
| InChIKey | XSAGUKFAYSVSMS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|