C37H25N3O6 — CID 135998533
2-(4-cyclopentylphenyl)-5-[1,3-dioxo-2-(4-oxo-3H-quinazolin-2-yl)indene-5-carbonyl]isoindole-1,3-dione (PubChem CID 135998533) has the molecular formula C37H25N3O6 and a molecular weight of 607.62 g/mol. Its IUPAC name is 2-(4-cyclopentylphenyl)-5-[1,3-dioxo-2-(4-oxo-3H-quinazolin-2-yl)indene-5-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-(4-cyclopentylphenyl)-5-[1,3-dioxo-2-(4-oxo-3H-quinazolin-2-yl)indene-5-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 135998533 |
| Molecular Formula | C37H25N3O6 |
| Molecular Weight | 607.62 g/mol |
| Exact Mass | 607.17 |
| IUPAC Name | 2-(4-cyclopentylphenyl)-5-[1,3-dioxo-2-(4-oxo-3H-quinazolin-2-yl)indene-5-carbonyl]isoindole-1,3-dione |
| SMILES | O=C(c1ccc2c(c1)C(=O)C(c1nc3ccccc3c(=O)[nH]1)C2=O)c1ccc2c(c1)C(=O)N(c1ccc(C3CCCC3)cc1)C2=O |
| InChI | InChI=1S/C37H25N3O6/c41-31(21-11-15-24-27(17-21)33(43)30(32(24)42)34-38-29-8-4-3-7-26(29)35(44)39-34)22-12-16-25-28(18-22)37(46)40(36(25)45)23-13-9-20(10-14-23)19-5-1-2-6-19/h3-4,7-19,30H,1-2,5-6H2,(H,38,39,44) |
| InChIKey | OGMKMJDCUIJSEX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 134.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.62 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|