C39H31N3O8 — CID 135998561
[2-[2-(4-cyclopentyl-2-propan-2-yloxyphenyl)-1,3,6,8-tetraoxoindeno[5,6-f]isoindol-7-yl]-4-oxo-3H-quinazolin-6-yl] acetate (PubChem CID 135998561) has the molecular formula C39H31N3O8 and a molecular weight of 669.69 g/mol. Its IUPAC name is [2-[2-(4-cyclopentyl-2-propan-2-yloxyphenyl)-1,3,6,8-tetraoxoindeno[5,6-f]isoindol-7-yl]-4-oxo-3H-quinazolin-6-yl] acetate.
| Compound Name | [2-[2-(4-cyclopentyl-2-propan-2-yloxyphenyl)-1,3,6,8-tetraoxoindeno[5,6-f]isoindol-7-yl]-4-oxo-3H-quinazolin-6-yl] acetate |
|---|---|
| PubChem CID | 135998561 |
| Molecular Formula | C39H31N3O8 |
| Molecular Weight | 669.69 g/mol |
| Exact Mass | 669.21 |
| IUPAC Name | [2-[2-(4-cyclopentyl-2-propan-2-yloxyphenyl)-1,3,6,8-tetraoxoindeno[5,6-f]isoindol-7-yl]-4-oxo-3H-quinazolin-6-yl] acetate |
| SMILES | CC(=O)Oc1ccc2nc(C3C(=O)c4cc5cc6c(cc5cc4C3=O)C(=O)N(c3ccc(C4CCCC4)cc3OC(C)C)C6=O)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C39H31N3O8/c1-18(2)49-32-16-21(20-6-4-5-7-20)8-11-31(32)42-38(47)27-14-22-12-25-26(13-23(22)15-28(27)39(42)48)35(45)33(34(25)44)36-40-30-10-9-24(50-19(3)43)17-29(30)37(46)41-36/h8-18,20,33H,4-7H2,1-3H3,(H,40,41,46) |
| InChIKey | AHSXBYAWVRQUGA-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 152.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.69 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|