C43H33N3O5 — CID 135998576
13-(6-benzyl-4-oxo-3H-quinazolin-2-yl)-6-(4-cyclopentyl-2,3-dimethylphenyl)-6-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 135998576) has the molecular formula C43H33N3O5 and a molecular weight of 671.75 g/mol. Its IUPAC name is 13-(6-benzyl-4-oxo-3H-quinazolin-2-yl)-6-(4-cyclopentyl-2,3-dimethylphenyl)-6-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 13-(6-benzyl-4-oxo-3H-quinazolin-2-yl)-6-(4-cyclopentyl-2,3-dimethylphenyl)-6-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 135998576 |
| Molecular Formula | C43H33N3O5 |
| Molecular Weight | 671.75 g/mol |
| Exact Mass | 671.24 |
| IUPAC Name | 13-(6-benzyl-4-oxo-3H-quinazolin-2-yl)-6-(4-cyclopentyl-2,3-dimethylphenyl)-6-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | Cc1c(C2CCCC2)ccc(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)C(c2nc3ccc(Cc5ccccc5)cc3c(=O)[nH]2)C4=O)c1C |
| InChI | InChI=1S/C43H33N3O5/c1-22-23(2)34(19-17-27(22)26-10-6-7-11-26)46-42(50)30-15-13-28-35-29(14-16-31(36(30)35)43(46)51)39(48)37(38(28)47)40-44-33-18-12-25(21-32(33)41(49)45-40)20-24-8-4-3-5-9-24/h3-5,8-9,12-19,21,26,37H,6-7,10-11,20H2,1-2H3,(H,44,45,49) |
| InChIKey | TUAHADPXUIEQIH-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.75 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|