C37H35N3O6 — CID 135998601
2-[2-cyclopentyl-5-(2,4-dimethylpentan-3-yloxy)phenyl]-6-(4-oxo-3H-quinazolin-2-yl)cyclopenta[f]isoindole-1,3,5,7-tetrone (PubChem CID 135998601) has the molecular formula C37H35N3O6 and a molecular weight of 617.70 g/mol. Its IUPAC name is 2-[2-cyclopentyl-5-(2,4-dimethylpentan-3-yloxy)phenyl]-6-(4-oxo-3H-quinazolin-2-yl)cyclopenta[f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-[2-cyclopentyl-5-(2,4-dimethylpentan-3-yloxy)phenyl]-6-(4-oxo-3H-quinazolin-2-yl)cyclopenta[f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 135998601 |
| Molecular Formula | C37H35N3O6 |
| Molecular Weight | 617.70 g/mol |
| Exact Mass | 617.25 |
| IUPAC Name | 2-[2-cyclopentyl-5-(2,4-dimethylpentan-3-yloxy)phenyl]-6-(4-oxo-3H-quinazolin-2-yl)cyclopenta[f]isoindole-1,3,5,7-tetrone |
| SMILES | CC(C)C(Oc1ccc(C2CCCC2)c(N2C(=O)c3cc4c(cc3C2=O)C(=O)C(c2nc3ccccc3c(=O)[nH]2)C4=O)c1)C(C)C |
| InChI | InChI=1S/C37H35N3O6/c1-18(2)33(19(3)4)46-21-13-14-22(20-9-5-6-10-20)29(15-21)40-36(44)26-16-24-25(17-27(26)37(40)45)32(42)30(31(24)41)34-38-28-12-8-7-11-23(28)35(43)39-34/h7-8,11-20,30,33H,5-6,9-10H2,1-4H3,(H,38,39,43) |
| InChIKey | ONTOTPJDCVICRY-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.70 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|