C22H18FN5O2S — CID 135998706
4-[10-(6-fluoroquinolin-3-yl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-7-yl]thiane 1,1-dioxide (PubChem CID 135998706) has the molecular formula C22H18FN5O2S and a molecular weight of 435.48 g/mol. Its IUPAC name is 4-[10-(6-fluoroquinolin-3-yl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-7-yl]thiane 1,1-dioxide.
| Compound Name | 4-[10-(6-fluoroquinolin-3-yl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-7-yl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 135998706 |
| Molecular Formula | C22H18FN5O2S |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 4-[10-(6-fluoroquinolin-3-yl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-7-yl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(c2nc3c(-c4cnc5ccc(F)cc5c4)cnn3c3[nH]ccc23)CC1 |
| InChI | InChI=1S/C22H18FN5O2S/c23-16-1-2-19-14(10-16)9-15(11-25-19)18-12-26-28-21-17(3-6-24-21)20(27-22(18)28)13-4-7-31(29,30)8-5-13/h1-3,6,9-13,24H,4-5,7-8H2 |
| InChIKey | SMKLTNQRSOPFBF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |