C11H15ClN4O7 — CID 135998761
(1R,2S,3R)-1-[2-(5-methyl-4-nitro-1,2-oxazol-3-yl)-1H-imidazol-5-yl]butane-1,2,3,4-tetrol;hydrochloride (PubChem CID 135998761) has the molecular formula C11H15ClN4O7 and a molecular weight of 350.72 g/mol. Its IUPAC name is (1R,2S,3R)-1-[2-(5-methyl-4-nitro-1,2-oxazol-3-yl)-1H-imidazol-5-yl]butane-1,2,3,4-tetrol;hydrochloride.
| Compound Name | (1R,2S,3R)-1-[2-(5-methyl-4-nitro-1,2-oxazol-3-yl)-1H-imidazol-5-yl]butane-1,2,3,4-tetrol;hydrochloride |
|---|---|
| PubChem CID | 135998761 |
| Molecular Formula | C11H15ClN4O7 |
| Molecular Weight | 350.72 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (1R,2S,3R)-1-[2-(5-methyl-4-nitro-1,2-oxazol-3-yl)-1H-imidazol-5-yl]butane-1,2,3,4-tetrol;hydrochloride |
| SMILES | Cc1onc(-c2ncc([C@@H](O)[C@H](O)[C@H](O)CO)[nH]2)c1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C11H14N4O7.ClH/c1-4-8(15(20)21)7(14-22-4)11-12-2-5(13-11)9(18)10(19)6(17)3-16;/h2,6,9-10,16-19H,3H2,1H3,(H,12,13);1H/t6-,9-,10-;/m1./s1 |
| InChIKey | ZPANBPZPQCRSIE-PUOQQAPDSA-N |
| XLogP | -0.55 |
| TPSA | 178.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.72 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|