C21H33N3O3 — CID 135998798
methyl (4S,5S,6R)-1-ethyl-6-methyl-4-phenyl-2-(3-propan-2-yloxypropylimino)-1,3-diazinane-5-carboxylate (PubChem CID 135998798) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is methyl (4S,5S,6R)-1-ethyl-6-methyl-4-phenyl-2-(3-propan-2-yloxypropylimino)-1,3-diazinane-5-carboxylate.
| Compound Name | methyl (4S,5S,6R)-1-ethyl-6-methyl-4-phenyl-2-(3-propan-2-yloxypropylimino)-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 135998798 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | methyl (4S,5S,6R)-1-ethyl-6-methyl-4-phenyl-2-(3-propan-2-yloxypropylimino)-1,3-diazinane-5-carboxylate |
| SMILES | CCN1/C(=N\CCCOC(C)C)N[C@H](c2ccccc2)[C@H](C(=O)OC)[C@H]1C |
| InChI | InChI=1S/C21H33N3O3/c1-6-24-16(4)18(20(25)26-5)19(17-11-8-7-9-12-17)23-21(24)22-13-10-14-27-15(2)3/h7-9,11-12,15-16,18-19H,6,10,13-14H2,1-5H3,(H,22,23)/t16-,18-,19-/m1/s1 |
| InChIKey | YDRNLDNTYMCTTD-BHIYHBOVSA-N |
| XLogP | 3.00 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|