C23H37N3O3 — CID 135998807
methyl (4S,5S,6R)-1-ethyl-6-methyl-4-(2-phenylethyl)-2-(3-propan-2-yloxypropylimino)-1,3-diazinane-5-carboxylate (PubChem CID 135998807) has the molecular formula C23H37N3O3 and a molecular weight of 403.57 g/mol. Its IUPAC name is methyl (4S,5S,6R)-1-ethyl-6-methyl-4-(2-phenylethyl)-2-(3-propan-2-yloxypropylimino)-1,3-diazinane-5-carboxylate.
| Compound Name | methyl (4S,5S,6R)-1-ethyl-6-methyl-4-(2-phenylethyl)-2-(3-propan-2-yloxypropylimino)-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 135998807 |
| Molecular Formula | C23H37N3O3 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | methyl (4S,5S,6R)-1-ethyl-6-methyl-4-(2-phenylethyl)-2-(3-propan-2-yloxypropylimino)-1,3-diazinane-5-carboxylate |
| SMILES | CCN1/C(=N\CCCOC(C)C)N[C@@H](CCc2ccccc2)[C@H](C(=O)OC)[C@H]1C |
| InChI | InChI=1S/C23H37N3O3/c1-6-26-18(4)21(22(27)28-5)20(14-13-19-11-8-7-9-12-19)25-23(26)24-15-10-16-29-17(2)3/h7-9,11-12,17-18,20-21H,6,10,13-16H2,1-5H3,(H,24,25)/t18-,20+,21-/m1/s1 |
| InChIKey | MKOLUMDQCMYNRG-HLAWJBBLSA-N |
| XLogP | 3.26 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|