C24H32N4O2 — CID 135998830
methyl (4R,5S,6R)-1-ethyl-6-methyl-4-(2-phenylethyl)-2-(2-pyridin-3-ylethylimino)-1,3-diazinane-5-carboxylate (PubChem CID 135998830) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is methyl (4R,5S,6R)-1-ethyl-6-methyl-4-(2-phenylethyl)-2-(2-pyridin-3-ylethylimino)-1,3-diazinane-5-carboxylate.
| Compound Name | methyl (4R,5S,6R)-1-ethyl-6-methyl-4-(2-phenylethyl)-2-(2-pyridin-3-ylethylimino)-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 135998830 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | methyl (4R,5S,6R)-1-ethyl-6-methyl-4-(2-phenylethyl)-2-(2-pyridin-3-ylethylimino)-1,3-diazinane-5-carboxylate |
| SMILES | CCN1/C(=N\CCc2cccnc2)N[C@H](CCc2ccccc2)[C@H](C(=O)OC)[C@H]1C |
| InChI | InChI=1S/C24H32N4O2/c1-4-28-18(2)22(23(29)30-3)21(13-12-19-9-6-5-7-10-19)27-24(28)26-16-14-20-11-8-15-25-17-20/h5-11,15,17-18,21-22H,4,12-14,16H2,1-3H3,(H,26,27)/t18-,21-,22-/m1/s1 |
| InChIKey | OVNLLXPWBPMUSX-STZQEDGTSA-N |
| XLogP | 3.08 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|