C10H19Cl2N5O3 — CID 135998855
2-amino-6-(2-methoxyethoxymethyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one;dihydrochloride (PubChem CID 135998855) has the molecular formula C10H19Cl2N5O3 and a molecular weight of 328.20 g/mol. Its IUPAC name is 2-amino-6-(2-methoxyethoxymethyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one;dihydrochloride.
| Compound Name | 2-amino-6-(2-methoxyethoxymethyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one;dihydrochloride |
|---|---|
| PubChem CID | 135998855 |
| Molecular Formula | C10H19Cl2N5O3 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-amino-6-(2-methoxyethoxymethyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one;dihydrochloride |
| SMILES | COCCOCC1CNc2nc(N)[nH]c(=O)c2N1.Cl.Cl |
| InChI | InChI=1S/C10H17N5O3.2ClH/c1-17-2-3-18-5-6-4-12-8-7(13-6)9(16)15-10(11)14-8;;/h6,13H,2-5H2,1H3,(H4,11,12,14,15,16);2*1H |
| InChIKey | NXWDXYBXJSOGAR-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|