C11H21Cl2N5O2 — CID 135998862
2-amino-6-(butoxymethyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one;dihydrochloride (PubChem CID 135998862) has the molecular formula C11H21Cl2N5O2 and a molecular weight of 326.23 g/mol. Its IUPAC name is 2-amino-6-(butoxymethyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one;dihydrochloride.
| Compound Name | 2-amino-6-(butoxymethyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one;dihydrochloride |
|---|---|
| PubChem CID | 135998862 |
| Molecular Formula | C11H21Cl2N5O2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-amino-6-(butoxymethyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one;dihydrochloride |
| SMILES | CCCCOCC1CNc2nc(N)[nH]c(=O)c2N1.Cl.Cl |
| InChI | InChI=1S/C11H19N5O2.2ClH/c1-2-3-4-18-6-7-5-13-9-8(14-7)10(17)16-11(12)15-9;;/h7,14H,2-6H2,1H3,(H4,12,13,15,16,17);2*1H |
| InChIKey | NPYMIAZVPQOMOB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|