About 1-methylpiperidin-2-one
1-methylpiperidin-2-one (PubChem CID 13603) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is 1-methylpiperidin-2-one.
Molecular Properties
| Compound Name | 1-methylpiperidin-2-one |
| PubChem CID | 13603 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 1-methylpiperidin-2-one |
| SMILES | CN1CCCCC1=O |
| InChI | InChI=1S/C6H11NO/c1-7-5-3-2-4-6(7)8/h2-5H2,1H3 |
| InChIKey | GGYVTHJIUNGKFZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperidin-2-one?
The IUPAC name of 1-methylpiperidin-2-one (CID 13603) is 1-methylpiperidin-2-one.
What is the SMILES notation for 1-methylpiperidin-2-one?
The canonical SMILES for 1-methylpiperidin-2-one is CN1CCCCC1=O.
What is the InChIKey of 1-methylpiperidin-2-one?
The InChIKey is GGYVTHJIUNGKFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c1-7-5-3-2-4-6(7)8/h2-5H2,1H3.
What are the key properties of 1-methylpiperidin-2-one?
1-methylpiperidin-2-one has a molecular weight of 113.16 g/mol, XLogP of 0.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperidin-2-one is sourced from PubChem (CID 13603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).