About 2-ethyl-5-methyl-4,5-dihydro-1H-imidazole
2-ethyl-5-methyl-4,5-dihydro-1H-imidazole (PubChem CID 13604) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is 2-ethyl-5-methyl-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-ethyl-5-methyl-4,5-dihydro-1H-imidazole |
| PubChem CID | 13604 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 2-ethyl-5-methyl-4,5-dihydro-1H-imidazole |
| SMILES | CCC1=NCC(C)N1 |
| InChI | InChI=1S/C6H12N2/c1-3-6-7-4-5(2)8-6/h5H,3-4H2,1-2H3,(H,7,8) |
| InChIKey | SHYARJUKNREDGB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-5-methyl-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-methyl-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-ethyl-5-methyl-4,5-dihydro-1H-imidazole (CID 13604) is 2-ethyl-5-methyl-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-ethyl-5-methyl-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-ethyl-5-methyl-4,5-dihydro-1H-imidazole is CCC1=NCC(C)N1.
What is the InChIKey of 2-ethyl-5-methyl-4,5-dihydro-1H-imidazole?
The InChIKey is SHYARJUKNREDGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2/c1-3-6-7-4-5(2)8-6/h5H,3-4H2,1-2H3,(H,7,8).
What are the key properties of 2-ethyl-5-methyl-4,5-dihydro-1H-imidazole?
2-ethyl-5-methyl-4,5-dihydro-1H-imidazole has a molecular weight of 112.18 g/mol, XLogP of 0.79, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-methyl-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 13604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).