C10H9Cl2N3O2S2 — CID 1360720
5-[2-(2,5-dichlorophenyl)sulfonylethyl]-1,3,4-thiadiazol-2-amine (PubChem CID 1360720) has the molecular formula C10H9Cl2N3O2S2 and a molecular weight of 338.24 g/mol. Its IUPAC name is 5-[2-(2,5-dichlorophenyl)sulfonylethyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-(2,5-dichlorophenyl)sulfonylethyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 1360720 |
| Molecular Formula | C10H9Cl2N3O2S2 |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 336.95 |
| IUPAC Name | 5-[2-(2,5-dichlorophenyl)sulfonylethyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(CCS(=O)(=O)c2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C10H9Cl2N3O2S2/c11-6-1-2-7(12)8(5-6)19(16,17)4-3-9-14-15-10(13)18-9/h1-2,5H,3-4H2,(H2,13,15) |
| InChIKey | YOIFXJDYJOLCPA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |