About 5-bromo-4-chloro-2-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1H-indol-3-ol
5-bromo-4-chloro-2-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1H-indol-3-ol (PubChem CID 1361017) has the molecular formula C16H18BrClN2O
and a molecular weight of 369.69 g/mol. Its IUPAC name is 5-bromo-4-chloro-2-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1H-indol-3-ol.
Molecular Properties
| Compound Name | 5-bromo-4-chloro-2-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1H-indol-3-ol |
| PubChem CID | 1361017 |
| Molecular Formula | C16H18BrClN2O |
| Molecular Weight | 369.69 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 5-bromo-4-chloro-2-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1H-indol-3-ol |
| SMILES | C[C@H]1CCCC[C@@H]1/N=C/c1[nH]c2ccc(Br)c(Cl)c2c1O |
| InChI | InChI=1S/C16H18BrClN2O/c1-9-4-2-3-5-11(9)19-8-13-16(21)14-12(20-13)7-6-10(17)15(14)18/h6-9,11,20-21H,2-5H2,1H3/b19-8+/t9-,11-/m0/s1 |
| InChIKey | MJVLAVDPXAOLQA-WMFDGFHISA-N |
| XLogP | 5.29 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.69 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-4-chloro-2-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1H-indol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-chloro-2-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1H-indol-3-ol?
The IUPAC name of 5-bromo-4-chloro-2-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1H-indol-3-ol (CID 1361017) is 5-bromo-4-chloro-2-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1H-indol-3-ol.
What is the SMILES notation for 5-bromo-4-chloro-2-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1H-indol-3-ol?
The canonical SMILES for 5-bromo-4-chloro-2-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1H-indol-3-ol is C[C@H]1CCCC[C@@H]1/N=C/c1[nH]c2ccc(Br)c(Cl)c2c1O.
What is the InChIKey of 5-bromo-4-chloro-2-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1H-indol-3-ol?
The InChIKey is MJVLAVDPXAOLQA-WMFDGFHISA-N. The full InChI is InChI=1S/C16H18BrClN2O/c1-9-4-2-3-5-11(9)19-8-13-16(21)14-12(20-13)7-6-10(17)15(14)18/h6-9,11,20-21H,2-5H2,1H3/b19-8+/t9-,11-/m0/s1.
What are the key properties of 5-bromo-4-chloro-2-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1H-indol-3-ol?
5-bromo-4-chloro-2-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1H-indol-3-ol has a molecular weight of 369.69 g/mol, XLogP of 5.29, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-chloro-2-[[(1S,2S)-2-methylcyclohexyl]iminomethyl]-1H-indol-3-ol is sourced from PubChem (CID 1361017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).