C4H9NOS — CID 1361796
(3S,4S)-4-aminothiolan-3-ol (PubChem CID 1361796) has the molecular formula C4H9NOS and a molecular weight of 119.19 g/mol. Its IUPAC name is (3S,4S)-4-aminothiolan-3-ol.
| Compound Name | (3S,4S)-4-aminothiolan-3-ol |
|---|---|
| PubChem CID | 1361796 |
| Molecular Formula | C4H9NOS |
| Molecular Weight | 119.19 g/mol |
| Exact Mass | 119.04 |
| IUPAC Name | (3S,4S)-4-aminothiolan-3-ol |
| SMILES | N[C@@H]1CSC[C@H]1O |
| InChI | InChI=1S/C4H9NOS/c5-3-1-7-2-4(3)6/h3-4,6H,1-2,5H2/t3-,4-/m1/s1 |
| InChIKey | LNYNSKJTNYTLNL-QWWZWVQMSA-N |
| XLogP | -0.58 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.19 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |