About 2,3,6-trichlorophenol
2,3,6-trichlorophenol (PubChem CID 13618) has the molecular formula C6H3Cl3O
and a molecular weight of 197.45 g/mol. Its IUPAC name is 2,3,6-trichlorophenol.
Molecular Properties
| Compound Name | 2,3,6-trichlorophenol |
| PubChem CID | 13618 |
| Molecular Formula | C6H3Cl3O |
| Molecular Weight | 197.45 g/mol |
| Exact Mass | 195.92 |
| IUPAC Name | 2,3,6-trichlorophenol |
| SMILES | Oc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C6H3Cl3O/c7-3-1-2-4(8)6(10)5(3)9/h1-2,10H |
| InChIKey | XGCHAIDDPMFRLJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3,6-trichlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,6-trichlorophenol?
The IUPAC name of 2,3,6-trichlorophenol (CID 13618) is 2,3,6-trichlorophenol.
What is the SMILES notation for 2,3,6-trichlorophenol?
The canonical SMILES for 2,3,6-trichlorophenol is Oc1c(Cl)ccc(Cl)c1Cl.
What is the InChIKey of 2,3,6-trichlorophenol?
The InChIKey is XGCHAIDDPMFRLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl3O/c7-3-1-2-4(8)6(10)5(3)9/h1-2,10H.
What are the key properties of 2,3,6-trichlorophenol?
2,3,6-trichlorophenol has a molecular weight of 197.45 g/mol, XLogP of 3.35, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6-trichlorophenol is sourced from PubChem (CID 13618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).