C16H9Cl2NO2S — CID 1362614
5-[(2,3-dichlorophenyl)methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione (PubChem CID 1362614) has the molecular formula C16H9Cl2NO2S and a molecular weight of 350.23 g/mol. Its IUPAC name is 5-[(2,3-dichlorophenyl)methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(2,3-dichlorophenyl)methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1362614 |
| Molecular Formula | C16H9Cl2NO2S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 5-[(2,3-dichlorophenyl)methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2cccc(Cl)c2Cl)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C16H9Cl2NO2S/c17-12-8-4-5-10(14(12)18)9-13-15(20)19(16(21)22-13)11-6-2-1-3-7-11/h1-9H |
| InChIKey | DFNCJBWOFMPZAQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|