About N-(2-methoxy-5-nitrophenyl)-3,3-diphenylpropanamide
N-(2-methoxy-5-nitrophenyl)-3,3-diphenylpropanamide (PubChem CID 1362633) has the molecular formula C22H20N2O4
and a molecular weight of 376.41 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-3,3-diphenylpropanamide.
Molecular Properties
| Compound Name | N-(2-methoxy-5-nitrophenyl)-3,3-diphenylpropanamide |
| PubChem CID | 1362633 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-3,3-diphenylpropanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20N2O4/c1-28-21-13-12-18(24(26)27)14-20(21)23-22(25)15-19(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-14,19H,15H2,1H3,(H,23,25) |
| InChIKey | ZZNWVXVHULEUDE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxy-5-nitrophenyl)-3,3-diphenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxy-5-nitrophenyl)-3,3-diphenylpropanamide?
The IUPAC name of N-(2-methoxy-5-nitrophenyl)-3,3-diphenylpropanamide (CID 1362633) is N-(2-methoxy-5-nitrophenyl)-3,3-diphenylpropanamide.
What is the SMILES notation for N-(2-methoxy-5-nitrophenyl)-3,3-diphenylpropanamide?
The canonical SMILES for N-(2-methoxy-5-nitrophenyl)-3,3-diphenylpropanamide is COc1ccc([N+](=O)[O-])cc1NC(=O)CC(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(2-methoxy-5-nitrophenyl)-3,3-diphenylpropanamide?
The InChIKey is ZZNWVXVHULEUDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O4/c1-28-21-13-12-18(24(26)27)14-20(21)23-22(25)15-19(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-14,19H,15H2,1H3,(H,23,25).
What are the key properties of N-(2-methoxy-5-nitrophenyl)-3,3-diphenylpropanamide?
N-(2-methoxy-5-nitrophenyl)-3,3-diphenylpropanamide has a molecular weight of 376.41 g/mol, XLogP of 4.76, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxy-5-nitrophenyl)-3,3-diphenylpropanamide is sourced from PubChem (CID 1362633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).